About calcium bis(decan-1-olate)
calcium bis(decan-1-olate) (PubChem CID 141290490) has the molecular formula C20H42CaO2
and a molecular weight of 354.63 g/mol. Its IUPAC name is calcium bis(decan-1-olate).
Molecular Properties
| Compound Name | calcium bis(decan-1-olate) |
| PubChem CID | 141290490 |
| Molecular Formula | C20H42CaO2 |
| Molecular Weight | 354.63 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | calcium bis(decan-1-olate) |
| SMILES | CCCCCCCCCC[O-].CCCCCCCCCC[O-].[Ca+2] |
| InChI | InChI=1S/2C10H21O.Ca/c2*1-2-3-4-5-6-7-8-9-10-11;/h2*2-10H2,1H3;/q2*-1;+2 |
| InChIKey | SIZPFBYDLGUIMU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.63 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze calcium bis(decan-1-olate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium bis(decan-1-olate)?
The IUPAC name of calcium bis(decan-1-olate) (CID 141290490) is calcium bis(decan-1-olate).
What is the SMILES notation for calcium bis(decan-1-olate)?
The canonical SMILES for calcium bis(decan-1-olate) is CCCCCCCCCC[O-].CCCCCCCCCC[O-].[Ca+2].
What is the InChIKey of calcium bis(decan-1-olate)?
The InChIKey is SIZPFBYDLGUIMU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H21O.Ca/c2*1-2-3-4-5-6-7-8-9-10-11;/h2*2-10H2,1H3;/q2*-1;+2.
What are the key properties of calcium bis(decan-1-olate)?
calcium bis(decan-1-olate) has a molecular weight of 354.63 g/mol, XLogP of 4.59, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for calcium bis(decan-1-olate) is sourced from PubChem (CID 141290490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).