C20H18F3N7O2 — CID 159487947
2-methoxy-4-[1-methyl-5-(1H-pyrazolo[5,4-b]pyridin-5-ylmethyl)-1,2,4-triazol-3-yl]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 159487947) has the molecular formula C20H18F3N7O2 and a molecular weight of 445.41 g/mol. Its IUPAC name is 2-methoxy-4-[1-methyl-5-(1H-pyrazolo[5,4-b]pyridin-5-ylmethyl)-1,2,4-triazol-3-yl]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-methoxy-4-[1-methyl-5-(1H-pyrazolo[5,4-b]pyridin-5-ylmethyl)-1,2,4-triazol-3-yl]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 159487947 |
| Molecular Formula | C20H18F3N7O2 |
| Molecular Weight | 445.41 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 2-methoxy-4-[1-methyl-5-(1H-pyrazolo[5,4-b]pyridin-5-ylmethyl)-1,2,4-triazol-3-yl]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | COc1cc(-c2nc(Cc3cnc4[nH]ncc4c3)n(C)n2)ccc1C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C20H18F3N7O2/c1-30-16(6-11-5-13-9-26-28-17(13)24-8-11)27-18(29-30)12-3-4-14(15(7-12)32-2)19(31)25-10-20(21,22)23/h3-5,7-9H,6,10H2,1-2H3,(H,25,31)(H,24,26,28) |
| InChIKey | WILJUUYEJWBKGX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 110.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |