C14H26N2O7 — CID 159490113
N-methoxy-N-methylacetamide;methyl (3S)-6-[methoxy(methyl)amino]-3-methyl-4,6-dioxohexanoate (PubChem CID 159490113) has the molecular formula C14H26N2O7 and a molecular weight of 334.37 g/mol. Its IUPAC name is N-methoxy-N-methylacetamide;methyl (3S)-6-[methoxy(methyl)amino]-3-methyl-4,6-dioxohexanoate.
| Compound Name | N-methoxy-N-methylacetamide;methyl (3S)-6-[methoxy(methyl)amino]-3-methyl-4,6-dioxohexanoate |
|---|---|
| PubChem CID | 159490113 |
| Molecular Formula | C14H26N2O7 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | N-methoxy-N-methylacetamide;methyl (3S)-6-[methoxy(methyl)amino]-3-methyl-4,6-dioxohexanoate |
| SMILES | COC(=O)C[C@H](C)C(=O)CC(=O)N(C)OC.CON(C)C(C)=O |
| InChI | InChI=1S/C10H17NO5.C4H9NO2/c1-7(5-10(14)15-3)8(12)6-9(13)11(2)16-4;1-4(6)5(2)7-3/h7H,5-6H2,1-4H3;1-3H3/t7-;/m0./s1 |
| InChIKey | LYBSIQCNSHHDMB-FJXQXJEOSA-N |
| XLogP | 0.19 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|