C27H36F12N4O6 — CID 159492278
2-O-tert-butyl 7-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 2,7-diazaspiro[3.5]nonane-2,7-dicarboxylate;1,1,1,3,3,3-hexafluoropropan-2-yl 2,7-diazaspiro[3.5]nonane-7-carboxylate (PubChem CID 159492278) has the molecular formula C27H36F12N4O6 and a molecular weight of 740.58 g/mol. Its IUPAC name is 2-O-tert-butyl 7-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 2,7-diazaspiro[3.5]nonane-2,7-dicarboxylate;1,1,1,3,3,3-hexafluoropropan-2-yl 2,7-diazaspiro[3.5]nonane-7-carboxylate.
| Compound Name | 2-O-tert-butyl 7-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 2,7-diazaspiro[3.5]nonane-2,7-dicarboxylate;1,1,1,3,3,3-hexafluoropropan-2-yl 2,7-diazaspiro[3.5]nonane-7-carboxylate |
|---|---|
| PubChem CID | 159492278 |
| Molecular Formula | C27H36F12N4O6 |
| Molecular Weight | 740.58 g/mol |
| Exact Mass | 740.24 |
| IUPAC Name | 2-O-tert-butyl 7-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 2,7-diazaspiro[3.5]nonane-2,7-dicarboxylate;1,1,1,3,3,3-hexafluoropropan-2-yl 2,7-diazaspiro[3.5]nonane-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC2)C1.O=C(OC(C(F)(F)F)C(F)(F)F)N1CCC2(CC1)CNC2 |
| InChI | InChI=1S/C16H22F6N2O4.C11H14F6N2O2/c1-13(2,3)28-12(26)24-8-14(9-24)4-6-23(7-5-14)11(25)27-10(15(17,18)19)16(20,21)22;12-10(13,14)7(11(15,16)17)21-8(20)19-3-1-9(2-4-19)5-18-6-9/h10H,4-9H2,1-3H3;7,18H,1-6H2 |
| InChIKey | LYIOIXDBZVHBEZ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.58 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|