C18H26N2O6 — CID 15949326
2-[carboxymethyl-[2-(2-hexoxyanilino)-2-oxoethyl]amino]acetic acid (PubChem CID 15949326) has the molecular formula C18H26N2O6 and a molecular weight of 366.41 g/mol. Its IUPAC name is 2-[carboxymethyl-[2-(2-hexoxyanilino)-2-oxoethyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[2-(2-hexoxyanilino)-2-oxoethyl]amino]acetic acid |
|---|---|
| PubChem CID | 15949326 |
| Molecular Formula | C18H26N2O6 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 2-[carboxymethyl-[2-(2-hexoxyanilino)-2-oxoethyl]amino]acetic acid |
| SMILES | CCCCCCOc1ccccc1NC(=O)CN(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C18H26N2O6/c1-2-3-4-7-10-26-15-9-6-5-8-14(15)19-16(21)11-20(12-17(22)23)13-18(24)25/h5-6,8-9H,2-4,7,10-13H2,1H3,(H,19,21)(H,22,23)(H,24,25) |
| InChIKey | OVMLLDXAYBWFBC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|