C15H20ClNO3 — CID 159494377
methyl (2S)-5-(2-amino-4-chlorophenyl)-4-oxo-2-propan-2-ylpentanoate (PubChem CID 159494377) has the molecular formula C15H20ClNO3 and a molecular weight of 297.78 g/mol. Its IUPAC name is methyl (2S)-5-(2-amino-4-chlorophenyl)-4-oxo-2-propan-2-ylpentanoate.
| Compound Name | methyl (2S)-5-(2-amino-4-chlorophenyl)-4-oxo-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 159494377 |
| Molecular Formula | C15H20ClNO3 |
| Molecular Weight | 297.78 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | methyl (2S)-5-(2-amino-4-chlorophenyl)-4-oxo-2-propan-2-ylpentanoate |
| SMILES | COC(=O)[C@@H](CC(=O)Cc1ccc(Cl)cc1N)C(C)C |
| InChI | InChI=1S/C15H20ClNO3/c1-9(2)13(15(19)20-3)8-12(18)6-10-4-5-11(16)7-14(10)17/h4-5,7,9,13H,6,8,17H2,1-3H3/t13-/m0/s1 |
| InChIKey | LYPCJSDQTHXTCO-ZDUSSCGKSA-N |
| XLogP | 2.87 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.78 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|