C12H14ClFO3 — CID 114859945
methyl 2-[(5-chloro-2-fluorophenyl)-hydroxymethyl]butanoate (PubChem CID 114859945) has the molecular formula C12H14ClFO3 and a molecular weight of 260.69 g/mol. Its IUPAC name is methyl 2-[(5-chloro-2-fluorophenyl)-hydroxymethyl]butanoate.
| Compound Name | methyl 2-[(5-chloro-2-fluorophenyl)-hydroxymethyl]butanoate |
|---|---|
| PubChem CID | 114859945 |
| Molecular Formula | C12H14ClFO3 |
| Molecular Weight | 260.69 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | methyl 2-[(5-chloro-2-fluorophenyl)-hydroxymethyl]butanoate |
| SMILES | CCC(C(=O)OC)C(O)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C12H14ClFO3/c1-3-8(12(16)17-2)11(15)9-6-7(13)4-5-10(9)14/h4-6,8,11,15H,3H2,1-2H3 |
| InChIKey | FMGCMANIGLRLMG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.69 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |