C18H18BrN5O — CID 15949463
4-[2-amino-4-(3-bromophenyl)-1-methyl-5-oxoimidazol-4-yl]-1-propylpyrrole-2-carbonitrile (PubChem CID 15949463) has the molecular formula C18H18BrN5O and a molecular weight of 400.28 g/mol. Its IUPAC name is 4-[2-amino-4-(3-bromophenyl)-1-methyl-5-oxoimidazol-4-yl]-1-propylpyrrole-2-carbonitrile.
| Compound Name | 4-[2-amino-4-(3-bromophenyl)-1-methyl-5-oxoimidazol-4-yl]-1-propylpyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 15949463 |
| Molecular Formula | C18H18BrN5O |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | 4-[2-amino-4-(3-bromophenyl)-1-methyl-5-oxoimidazol-4-yl]-1-propylpyrrole-2-carbonitrile |
| SMILES | CCCn1cc(C2(c3cccc(Br)c3)N=C(N)N(C)C2=O)cc1C#N |
| InChI | InChI=1S/C18H18BrN5O/c1-3-7-24-11-13(9-15(24)10-20)18(12-5-4-6-14(19)8-12)16(25)23(2)17(21)22-18/h4-6,8-9,11H,3,7H2,1-2H3,(H2,21,22) |
| InChIKey | PSPVKSQMELZRHG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 87.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |