C17H16BrN3O4S — CID 90849888
[3-[2-amino-4-(3-bromophenyl)-1-methyl-5-oxoimidazol-4-yl]phenyl]methanesulfonic acid (PubChem CID 90849888) has the molecular formula C17H16BrN3O4S and a molecular weight of 438.30 g/mol. Its IUPAC name is [3-[2-amino-4-(3-bromophenyl)-1-methyl-5-oxoimidazol-4-yl]phenyl]methanesulfonic acid.
| Compound Name | [3-[2-amino-4-(3-bromophenyl)-1-methyl-5-oxoimidazol-4-yl]phenyl]methanesulfonic acid |
|---|---|
| PubChem CID | 90849888 |
| Molecular Formula | C17H16BrN3O4S |
| Molecular Weight | 438.30 g/mol |
| Exact Mass | 437.00 |
| IUPAC Name | [3-[2-amino-4-(3-bromophenyl)-1-methyl-5-oxoimidazol-4-yl]phenyl]methanesulfonic acid |
| SMILES | CN1C(=O)C(c2cccc(Br)c2)(c2cccc(CS(=O)(=O)O)c2)N=C1N |
| InChI | InChI=1S/C17H16BrN3O4S/c1-21-15(22)17(20-16(21)19,13-6-3-7-14(18)9-13)12-5-2-4-11(8-12)10-26(23,24)25/h2-9H,10H2,1H3,(H2,19,20)(H,23,24,25) |
| InChIKey | HPULVRIZZMLLLL-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|