C21H26O3S — CID 159497340
2,5-dimethyl-4-[(4-phenylphenyl)sulfonylmethyl]hexan-3-one (PubChem CID 159497340) has the molecular formula C21H26O3S and a molecular weight of 358.50 g/mol. Its IUPAC name is 2,5-dimethyl-4-[(4-phenylphenyl)sulfonylmethyl]hexan-3-one.
| Compound Name | 2,5-dimethyl-4-[(4-phenylphenyl)sulfonylmethyl]hexan-3-one |
|---|---|
| PubChem CID | 159497340 |
| Molecular Formula | C21H26O3S |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 2,5-dimethyl-4-[(4-phenylphenyl)sulfonylmethyl]hexan-3-one |
| SMILES | CC(C)C(=O)C(CS(=O)(=O)c1ccc(-c2ccccc2)cc1)C(C)C |
| InChI | InChI=1S/C21H26O3S/c1-15(2)20(21(22)16(3)4)14-25(23,24)19-12-10-18(11-13-19)17-8-6-5-7-9-17/h5-13,15-16,20H,14H2,1-4H3 |
| InChIKey | ZFHMHWJMTSWWCF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |