C34H32BBr2F2IN4O2 — CID 159510161
5-bromo-3-(4-fluoro-1H-inden-2-yl)pyridin-2-amine;5-bromo-3-iodopyridin-2-amine;2-(4-fluoro-1H-inden-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 159510161) has the molecular formula C34H32BBr2F2IN4O2 and a molecular weight of 864.18 g/mol. Its IUPAC name is 5-bromo-3-(4-fluoro-1H-inden-2-yl)pyridin-2-amine;5-bromo-3-iodopyridin-2-amine;2-(4-fluoro-1H-inden-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 5-bromo-3-(4-fluoro-1H-inden-2-yl)pyridin-2-amine;5-bromo-3-iodopyridin-2-amine;2-(4-fluoro-1H-inden-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 159510161 |
| Molecular Formula | C34H32BBr2F2IN4O2 |
| Molecular Weight | 864.18 g/mol |
| Exact Mass | 862.00 |
| IUPAC Name | 5-bromo-3-(4-fluoro-1H-inden-2-yl)pyridin-2-amine;5-bromo-3-iodopyridin-2-amine;2-(4-fluoro-1H-inden-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C2=Cc3c(F)cccc3C2)OC1(C)C.Nc1ncc(Br)cc1C1=Cc2c(F)cccc2C1.Nc1ncc(Br)cc1I |
| InChI | InChI=1S/C15H18BFO2.C14H10BrFN2.C5H4BrIN2/c1-14(2)15(3,4)19-16(18-14)11-8-10-6-5-7-13(17)12(10)9-11;15-10-6-12(14(17)18-7-10)9-4-8-2-1-3-13(16)11(8)5-9;6-3-1-4(7)5(8)9-2-3/h5-7,9H,8H2,1-4H3;1-3,5-7H,4H2,(H2,17,18);1-2H,(H2,8,9) |
| InChIKey | MAMLJPNVDFTXDB-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.18 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|