C36H40BBrF2N6O2 — CID 161000146
2-bromo-4-fluoro-6-propan-2-ylaniline;4-fluoro-2-(2-isocyano-4-pyridinyl)-6-propan-2-ylaniline;2-isocyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 161000146) has the molecular formula C36H40BBrF2N6O2 and a molecular weight of 717.47 g/mol. Its IUPAC name is 2-bromo-4-fluoro-6-propan-2-ylaniline;4-fluoro-2-(2-isocyano-4-pyridinyl)-6-propan-2-ylaniline;2-isocyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 2-bromo-4-fluoro-6-propan-2-ylaniline;4-fluoro-2-(2-isocyano-4-pyridinyl)-6-propan-2-ylaniline;2-isocyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 161000146 |
| Molecular Formula | C36H40BBrF2N6O2 |
| Molecular Weight | 717.47 g/mol |
| Exact Mass | 716.25 |
| IUPAC Name | 2-bromo-4-fluoro-6-propan-2-ylaniline;4-fluoro-2-(2-isocyano-4-pyridinyl)-6-propan-2-ylaniline;2-isocyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CC(C)c1cc(F)cc(Br)c1N.[C-]#[N+]c1cc(-c2cc(F)cc(C(C)C)c2N)ccn1.[C-]#[N+]c1cc(B2OC(C)(C)C(C)(C)O2)ccn1 |
| InChI | InChI=1S/C15H14FN3.C12H15BN2O2.C9H11BrFN/c1-9(2)12-7-11(16)8-13(15(12)17)10-4-5-19-14(6-10)18-3;1-11(2)12(3,4)17-13(16-11)9-6-7-15-10(8-9)14-5;1-5(2)7-3-6(11)4-8(10)9(7)12/h4-9H,17H2,1-2H3;6-8H,1-4H3;3-5H,12H2,1-2H3 |
| InChIKey | TVTNLEJQBVUAKH-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 105.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.47 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|