C36H38BBrN6O2 — CID 159333546
4-bromo-2-isocyanopyridine;5-(2-isocyano-4-pyridinyl)-2,3-dihydro-1H-inden-4-amine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-4-amine (PubChem CID 159333546) has the molecular formula C36H38BBrN6O2 and a molecular weight of 677.46 g/mol. Its IUPAC name is 4-bromo-2-isocyanopyridine;5-(2-isocyano-4-pyridinyl)-2,3-dihydro-1H-inden-4-amine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-4-amine.
| Compound Name | 4-bromo-2-isocyanopyridine;5-(2-isocyano-4-pyridinyl)-2,3-dihydro-1H-inden-4-amine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-4-amine |
|---|---|
| PubChem CID | 159333546 |
| Molecular Formula | C36H38BBrN6O2 |
| Molecular Weight | 677.46 g/mol |
| Exact Mass | 676.23 |
| IUPAC Name | 4-bromo-2-isocyanopyridine;5-(2-isocyano-4-pyridinyl)-2,3-dihydro-1H-inden-4-amine;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-4-amine |
| SMILES | CC1(C)OB(c2ccc3c(c2N)CCC3)OC1(C)C.[C-]#[N+]c1cc(-c2ccc3c(c2N)CCC3)ccn1.[C-]#[N+]c1cc(Br)ccn1 |
| InChI | InChI=1S/C15H22BNO2.C15H13N3.C6H3BrN2/c1-14(2)15(3,4)19-16(18-14)12-9-8-10-6-5-7-11(10)13(12)17;1-17-14-9-11(7-8-18-14)13-6-5-10-3-2-4-12(10)15(13)16;1-8-6-4-5(7)2-3-9-6/h8-9H,5-7,17H2,1-4H3;5-9H,2-4,16H2;2-4H |
| InChIKey | LFGAALCZOOUSEQ-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 105.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.46 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|