C30H24BrN5 — CID 159604967
4-(4-bromo-2,3-dihydro-1H-inden-5-yl)-2-isocyanopyridine;5-(2-isocyano-4-pyridinyl)-2,3-dihydro-1H-inden-4-amine (PubChem CID 159604967) has the molecular formula C30H24BrN5 and a molecular weight of 534.46 g/mol. Its IUPAC name is 4-(4-bromo-2,3-dihydro-1H-inden-5-yl)-2-isocyanopyridine;5-(2-isocyano-4-pyridinyl)-2,3-dihydro-1H-inden-4-amine.
| Compound Name | 4-(4-bromo-2,3-dihydro-1H-inden-5-yl)-2-isocyanopyridine;5-(2-isocyano-4-pyridinyl)-2,3-dihydro-1H-inden-4-amine |
|---|---|
| PubChem CID | 159604967 |
| Molecular Formula | C30H24BrN5 |
| Molecular Weight | 534.46 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | 4-(4-bromo-2,3-dihydro-1H-inden-5-yl)-2-isocyanopyridine;5-(2-isocyano-4-pyridinyl)-2,3-dihydro-1H-inden-4-amine |
| SMILES | [C-]#[N+]c1cc(-c2ccc3c(c2Br)CCC3)ccn1.[C-]#[N+]c1cc(-c2ccc3c(c2N)CCC3)ccn1 |
| InChI | InChI=1S/C15H11BrN2.C15H13N3/c2*1-17-14-9-11(7-8-18-14)13-6-5-10-3-2-4-12(10)15(13)16/h5-9H,2-4H2;5-9H,2-4,16H2 |
| InChIKey | MLYSDPRINOISHZ-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 60.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.46 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|