C30H24BBrF4N4O2 — CID 159825503
3-bromo-4-fluoropyridine;4-fluoro-3-(2-fluoro-5-isocyanophenyl)pyridine;2-(2-fluoro-5-isocyanophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 159825503) has the molecular formula C30H24BBrF4N4O2 and a molecular weight of 639.26 g/mol. Its IUPAC name is 3-bromo-4-fluoropyridine;4-fluoro-3-(2-fluoro-5-isocyanophenyl)pyridine;2-(2-fluoro-5-isocyanophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 3-bromo-4-fluoropyridine;4-fluoro-3-(2-fluoro-5-isocyanophenyl)pyridine;2-(2-fluoro-5-isocyanophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 159825503 |
| Molecular Formula | C30H24BBrF4N4O2 |
| Molecular Weight | 639.26 g/mol |
| Exact Mass | 638.11 |
| IUPAC Name | 3-bromo-4-fluoropyridine;4-fluoro-3-(2-fluoro-5-isocyanophenyl)pyridine;2-(2-fluoro-5-isocyanophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | Fc1ccncc1Br.[C-]#[N+]c1ccc(F)c(-c2cnccc2F)c1.[C-]#[N+]c1ccc(F)c(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C13H15BFNO2.C12H6F2N2.C5H3BrFN/c1-12(2)13(3,4)18-14(17-12)10-8-9(16-5)6-7-11(10)15;1-15-8-2-3-11(13)9(6-8)10-7-16-5-4-12(10)14;6-4-3-8-2-1-5(4)7/h6-8H,1-4H3;2-7H;1-3H |
| InChIKey | NMTYTSSVWYVGFF-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 52.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.26 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|