C18H38O10S2 — CID 159515193
2-butoxyethyl methanesulfonate;2-prop-2-enoxyethanol;2-prop-2-enoxyethyl methanesulfonate (PubChem CID 159515193) has the molecular formula C18H38O10S2 and a molecular weight of 478.63 g/mol. Its IUPAC name is 2-butoxyethyl methanesulfonate;2-prop-2-enoxyethanol;2-prop-2-enoxyethyl methanesulfonate.
| Compound Name | 2-butoxyethyl methanesulfonate;2-prop-2-enoxyethanol;2-prop-2-enoxyethyl methanesulfonate |
|---|---|
| PubChem CID | 159515193 |
| Molecular Formula | C18H38O10S2 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 2-butoxyethyl methanesulfonate;2-prop-2-enoxyethanol;2-prop-2-enoxyethyl methanesulfonate |
| SMILES | C=CCOCCO.C=CCOCCOS(C)(=O)=O.CCCCOCCOS(C)(=O)=O |
| InChI | InChI=1S/C7H16O4S.C6H12O4S.C5H10O2/c1-3-4-5-10-6-7-11-12(2,8)9;1-3-4-9-5-6-10-11(2,7)8;1-2-4-7-5-3-6/h3-7H2,1-2H3;3H,1,4-6H2,2H3;2,6H,1,3-5H2 |
| InChIKey | MBCIGLALTBEAJC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|