C18H16N4O2 — CID 15951576
4-methyl-1-oxo-N-pyridin-3-yl-2,3,4,9-tetrahydropyrido[3,4-b]indole-6-carboxamide (PubChem CID 15951576) has the molecular formula C18H16N4O2 and a molecular weight of 320.35 g/mol. Its IUPAC name is 4-methyl-1-oxo-N-pyridin-3-yl-2,3,4,9-tetrahydropyrido[3,4-b]indole-6-carboxamide.
| Compound Name | 4-methyl-1-oxo-N-pyridin-3-yl-2,3,4,9-tetrahydropyrido[3,4-b]indole-6-carboxamide |
|---|---|
| PubChem CID | 15951576 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 4-methyl-1-oxo-N-pyridin-3-yl-2,3,4,9-tetrahydropyrido[3,4-b]indole-6-carboxamide |
| SMILES | CC1CNC(=O)c2[nH]c3ccc(C(=O)Nc4cccnc4)cc3c21 |
| InChI | InChI=1S/C18H16N4O2/c1-10-8-20-18(24)16-15(10)13-7-11(4-5-14(13)22-16)17(23)21-12-3-2-6-19-9-12/h2-7,9-10,22H,8H2,1H3,(H,20,24)(H,21,23) |
| InChIKey | MZSMIEPPSMSLPK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|