C18H23NO2 — CID 159517709
trans-(2R,4R)-4-[[benzyl(2-hydroxyethyl)amino]methyl]-2-prop-2-ynylcyclopentan-1-one (PubChem CID 159517709) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is trans-(2R,4R)-4-[[benzyl(2-hydroxyethyl)amino]methyl]-2-prop-2-ynylcyclopentan-1-one.
| Compound Name | trans-(2R,4R)-4-[[benzyl(2-hydroxyethyl)amino]methyl]-2-prop-2-ynylcyclopentan-1-one |
|---|---|
| PubChem CID | 159517709 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | trans-(2R,4R)-4-[[benzyl(2-hydroxyethyl)amino]methyl]-2-prop-2-ynylcyclopentan-1-one |
| SMILES | C#CC[C@H]1C[C@@H](CN(CCO)Cc2ccccc2)CC1=O |
| InChI | InChI=1S/C18H23NO2/c1-2-6-17-11-16(12-18(17)21)14-19(9-10-20)13-15-7-4-3-5-8-15/h1,3-5,7-8,16-17,20H,6,9-14H2/t16-,17+/m1/s1 |
| InChIKey | DSFGGUXIYNQGHN-SJORKVTESA-N |
| XLogP | 2.10 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|