C14H6F8I2N2O2 — CID 159518900
2,2,2-trifluoro-1-(2-fluoro-4-iodo-3-pyridinyl)ethanol;2,2,2-trifluoro-1-(2-fluoro-4-iodo-3-pyridinyl)ethanone (PubChem CID 159518900) has the molecular formula C14H6F8I2N2O2 and a molecular weight of 640.01 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(2-fluoro-4-iodo-3-pyridinyl)ethanol;2,2,2-trifluoro-1-(2-fluoro-4-iodo-3-pyridinyl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(2-fluoro-4-iodo-3-pyridinyl)ethanol;2,2,2-trifluoro-1-(2-fluoro-4-iodo-3-pyridinyl)ethanone |
|---|---|
| PubChem CID | 159518900 |
| Molecular Formula | C14H6F8I2N2O2 |
| Molecular Weight | 640.01 g/mol |
| Exact Mass | 639.84 |
| IUPAC Name | 2,2,2-trifluoro-1-(2-fluoro-4-iodo-3-pyridinyl)ethanol;2,2,2-trifluoro-1-(2-fluoro-4-iodo-3-pyridinyl)ethanone |
| SMILES | O=C(c1c(I)ccnc1F)C(F)(F)F.OC(c1c(I)ccnc1F)C(F)(F)F |
| InChI | InChI=1S/C7H4F4INO.C7H2F4INO/c2*8-6-4(3(12)1-2-13-6)5(14)7(9,10)11/h1-2,5,14H;1-2H |
| InChIKey | MBOAZDSRKGFJMF-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.01 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|