About 3-ethoxycyclohex-2-en-1-one;ethyl 4-ethoxy-2-oxocyclohex-3-ene-1-carboxylate
3-ethoxycyclohex-2-en-1-one;ethyl 4-ethoxy-2-oxocyclohex-3-ene-1-carboxylate (PubChem CID 159519277) has the molecular formula C19H28O6
and a molecular weight of 352.43 g/mol. Its IUPAC name is 3-ethoxycyclohex-2-en-1-one;ethyl 4-ethoxy-2-oxocyclohex-3-ene-1-carboxylate.
Molecular Properties
| Compound Name | 3-ethoxycyclohex-2-en-1-one;ethyl 4-ethoxy-2-oxocyclohex-3-ene-1-carboxylate |
| PubChem CID | 159519277 |
| Molecular Formula | C19H28O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 3-ethoxycyclohex-2-en-1-one;ethyl 4-ethoxy-2-oxocyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(OCC)=CC1=O.CCOC1=CC(=O)CCC1 |
| InChI | InChI=1S/C11H16O4.C8H12O2/c1-3-14-8-5-6-9(10(12)7-8)11(13)15-4-2;1-2-10-8-5-3-4-7(9)6-8/h7,9H,3-6H2,1-2H3;6H,2-5H2,1H3 |
| InChIKey | MBPHXKSHQSTPRG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxycyclohex-2-en-1-one;ethyl 4-ethoxy-2-oxocyclohex-3-ene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxycyclohex-2-en-1-one;ethyl 4-ethoxy-2-oxocyclohex-3-ene-1-carboxylate?
The IUPAC name of 3-ethoxycyclohex-2-en-1-one;ethyl 4-ethoxy-2-oxocyclohex-3-ene-1-carboxylate (CID 159519277) is 3-ethoxycyclohex-2-en-1-one;ethyl 4-ethoxy-2-oxocyclohex-3-ene-1-carboxylate.
What is the SMILES notation for 3-ethoxycyclohex-2-en-1-one;ethyl 4-ethoxy-2-oxocyclohex-3-ene-1-carboxylate?
The canonical SMILES for 3-ethoxycyclohex-2-en-1-one;ethyl 4-ethoxy-2-oxocyclohex-3-ene-1-carboxylate is CCOC(=O)C1CCC(OCC)=CC1=O.CCOC1=CC(=O)CCC1.
What is the InChIKey of 3-ethoxycyclohex-2-en-1-one;ethyl 4-ethoxy-2-oxocyclohex-3-ene-1-carboxylate?
The InChIKey is MBPHXKSHQSTPRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O4.C8H12O2/c1-3-14-8-5-6-9(10(12)7-8)11(13)15-4-2;1-2-10-8-5-3-4-7(9)6-8/h7,9H,3-6H2,1-2H3;6H,2-5H2,1H3.
What are the key properties of 3-ethoxycyclohex-2-en-1-one;ethyl 4-ethoxy-2-oxocyclohex-3-ene-1-carboxylate?
3-ethoxycyclohex-2-en-1-one;ethyl 4-ethoxy-2-oxocyclohex-3-ene-1-carboxylate has a molecular weight of 352.43 g/mol, XLogP of 3.11, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxycyclohex-2-en-1-one;ethyl 4-ethoxy-2-oxocyclohex-3-ene-1-carboxylate is sourced from PubChem (CID 159519277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).