C19H18FN3O4 — CID 159521542
2-[[(2S,3R)-3-[1-(4-fluorophenyl)indazol-5-yl]oxybutan-2-yl]amino]-2-oxoacetic acid (PubChem CID 159521542) has the molecular formula C19H18FN3O4 and a molecular weight of 371.37 g/mol. Its IUPAC name is 2-[[(2S,3R)-3-[1-(4-fluorophenyl)indazol-5-yl]oxybutan-2-yl]amino]-2-oxoacetic acid.
| Compound Name | 2-[[(2S,3R)-3-[1-(4-fluorophenyl)indazol-5-yl]oxybutan-2-yl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 159521542 |
| Molecular Formula | C19H18FN3O4 |
| Molecular Weight | 371.37 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 2-[[(2S,3R)-3-[1-(4-fluorophenyl)indazol-5-yl]oxybutan-2-yl]amino]-2-oxoacetic acid |
| SMILES | C[C@H](NC(=O)C(=O)O)[C@@H](C)Oc1ccc2c(cnn2-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C19H18FN3O4/c1-11(22-18(24)19(25)26)12(2)27-16-7-8-17-13(9-16)10-21-23(17)15-5-3-14(20)4-6-15/h3-12H,1-2H3,(H,22,24)(H,25,26)/t11-,12+/m0/s1 |
| InChIKey | MBWCNCLCQOGHFP-NWDGAFQWSA-N |
| XLogP | 2.52 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|