C28H28FN3O2 — CID 88990844
N-[(1R,2S)-1-(2,5-dimethylphenyl)-1-[1-(4-fluorophenyl)indazol-5-yl]oxypropan-2-yl]-2-methylprop-2-enamide (PubChem CID 88990844) has the molecular formula C28H28FN3O2 and a molecular weight of 457.55 g/mol. Its IUPAC name is N-[(1R,2S)-1-(2,5-dimethylphenyl)-1-[1-(4-fluorophenyl)indazol-5-yl]oxypropan-2-yl]-2-methylprop-2-enamide.
| Compound Name | N-[(1R,2S)-1-(2,5-dimethylphenyl)-1-[1-(4-fluorophenyl)indazol-5-yl]oxypropan-2-yl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 88990844 |
| Molecular Formula | C28H28FN3O2 |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | N-[(1R,2S)-1-(2,5-dimethylphenyl)-1-[1-(4-fluorophenyl)indazol-5-yl]oxypropan-2-yl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)N[C@@H](C)[C@H](Oc1ccc2c(cnn2-c2ccc(F)cc2)c1)c1cc(C)ccc1C |
| InChI | InChI=1S/C28H28FN3O2/c1-17(2)28(33)31-20(5)27(25-14-18(3)6-7-19(25)4)34-24-12-13-26-21(15-24)16-30-32(26)23-10-8-22(29)9-11-23/h6-16,20,27H,1H2,2-5H3,(H,31,33)/t20-,27-/m0/s1 |
| InChIKey | OZUKJYXMQLFPSU-DCFHFQCYSA-N |
| XLogP | 5.98 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|