C40H44N2O4 — CID 159524254
ethane;2-[3-[9-[2-(2-methylprop-2-enoyloxy)ethyl]carbazol-1-yl]carbazol-9-yl]ethyl 2-methylprop-2-enoate (PubChem CID 159524254) has the molecular formula C40H44N2O4 and a molecular weight of 616.80 g/mol. Its IUPAC name is ethane;2-[3-[9-[2-(2-methylprop-2-enoyloxy)ethyl]carbazol-1-yl]carbazol-9-yl]ethyl 2-methylprop-2-enoate.
| Compound Name | ethane;2-[3-[9-[2-(2-methylprop-2-enoyloxy)ethyl]carbazol-1-yl]carbazol-9-yl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 159524254 |
| Molecular Formula | C40H44N2O4 |
| Molecular Weight | 616.80 g/mol |
| Exact Mass | 616.33 |
| IUPAC Name | ethane;2-[3-[9-[2-(2-methylprop-2-enoyloxy)ethyl]carbazol-1-yl]carbazol-9-yl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCn1c2ccccc2c2cc(-c3cccc4c5ccccc5n(CCOC(=O)C(=C)C)c34)ccc21.CC.CC |
| InChI | InChI=1S/C36H32N2O4.2C2H6/c1-23(2)35(39)41-20-18-37-31-14-7-6-11-28(31)30-22-25(16-17-33(30)37)26-12-9-13-29-27-10-5-8-15-32(27)38(34(26)29)19-21-42-36(40)24(3)4;2*1-2/h5-17,22H,1,3,18-21H2,2,4H3;2*1-2H3 |
| InChIKey | MCEPSEISZGZZTD-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.80 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|