C32H49N7O6S2 — CID 159524369
2-[2-(butylamino)ethylsulfonylmethyl]-1H-benzimidazole-4-carboxamide;2-(heptylsulfonylmethyl)-1H-benzimidazole-4-carboxamide;methane (PubChem CID 159524369) has the molecular formula C32H49N7O6S2 and a molecular weight of 691.92 g/mol. Its IUPAC name is 2-[2-(butylamino)ethylsulfonylmethyl]-1H-benzimidazole-4-carboxamide;2-(heptylsulfonylmethyl)-1H-benzimidazole-4-carboxamide;methane.
| Compound Name | 2-[2-(butylamino)ethylsulfonylmethyl]-1H-benzimidazole-4-carboxamide;2-(heptylsulfonylmethyl)-1H-benzimidazole-4-carboxamide;methane |
|---|---|
| PubChem CID | 159524369 |
| Molecular Formula | C32H49N7O6S2 |
| Molecular Weight | 691.92 g/mol |
| Exact Mass | 691.32 |
| IUPAC Name | 2-[2-(butylamino)ethylsulfonylmethyl]-1H-benzimidazole-4-carboxamide;2-(heptylsulfonylmethyl)-1H-benzimidazole-4-carboxamide;methane |
| SMILES | C.CCCCCCCS(=O)(=O)Cc1nc2c(C(N)=O)cccc2[nH]1.CCCCNCCS(=O)(=O)Cc1nc2c(C(N)=O)cccc2[nH]1 |
| InChI | InChI=1S/C16H23N3O3S.C15H22N4O3S.CH4/c1-2-3-4-5-6-10-23(21,22)11-14-18-13-9-7-8-12(16(17)20)15(13)19-14;1-2-3-7-17-8-9-23(21,22)10-13-18-12-6-4-5-11(15(16)20)14(12)19-13;/h7-9H,2-6,10-11H2,1H3,(H2,17,20)(H,18,19);4-6,17H,2-3,7-10H2,1H3,(H2,16,20)(H,18,19);1H4 |
| InChIKey | MCEYKNQLJILAEV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 223.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.92 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|