C14H18N4O — CID 11960530
2-(1,2-dimethylpyrrolidin-2-yl)-1H-benzimidazole-4-carboxamide (PubChem CID 11960530) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-(1,2-dimethylpyrrolidin-2-yl)-1H-benzimidazole-4-carboxamide.
| Compound Name | 2-(1,2-dimethylpyrrolidin-2-yl)-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 11960530 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 2-(1,2-dimethylpyrrolidin-2-yl)-1H-benzimidazole-4-carboxamide |
| SMILES | CN1CCCC1(C)c1nc2c(C(N)=O)cccc2[nH]1 |
| InChI | InChI=1S/C14H18N4O/c1-14(7-4-8-18(14)2)13-16-10-6-3-5-9(12(15)19)11(10)17-13/h3,5-6H,4,7-8H2,1-2H3,(H2,15,19)(H,16,17) |
| InChIKey | XMDBCOUWMGTQRZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |