About bromobenzene;ethyl 9H-carbazole-3-carboxylate;ethyl 9-phenylcarbazole-3-carboxylate
bromobenzene;ethyl 9H-carbazole-3-carboxylate;ethyl 9-phenylcarbazole-3-carboxylate (PubChem CID 159527065) has the molecular formula C42H35BrN2O4
and a molecular weight of 711.66 g/mol. Its IUPAC name is bromobenzene;ethyl 9H-carbazole-3-carboxylate;ethyl 9-phenylcarbazole-3-carboxylate.
Molecular Properties
| Compound Name | bromobenzene;ethyl 9H-carbazole-3-carboxylate;ethyl 9-phenylcarbazole-3-carboxylate |
| PubChem CID | 159527065 |
| Molecular Formula | C42H35BrN2O4 |
| Molecular Weight | 711.66 g/mol |
| Exact Mass | 710.18 |
| IUPAC Name | bromobenzene;ethyl 9H-carbazole-3-carboxylate;ethyl 9-phenylcarbazole-3-carboxylate |
| SMILES | Brc1ccccc1.CCOC(=O)c1ccc2[nH]c3ccccc3c2c1.CCOC(=O)c1ccc2c(c1)c1ccccc1n2-c1ccccc1 |
| InChI | InChI=1S/C21H17NO2.C15H13NO2.C6H5Br/c1-2-24-21(23)15-12-13-20-18(14-15)17-10-6-7-11-19(17)22(20)16-8-4-3-5-9-16;1-2-18-15(17)10-7-8-14-12(9-10)11-5-3-4-6-13(11)16-14;7-6-4-2-1-3-5-6/h3-14H,2H2,1H3;3-9,16H,2H2,1H3;1-5H |
| InChIKey | MCNDBNLHGFFYHP-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 711.66 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bromobenzene;ethyl 9H-carbazole-3-carboxylate;ethyl 9-phenylcarbazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromobenzene;ethyl 9H-carbazole-3-carboxylate;ethyl 9-phenylcarbazole-3-carboxylate?
The IUPAC name of bromobenzene;ethyl 9H-carbazole-3-carboxylate;ethyl 9-phenylcarbazole-3-carboxylate (CID 159527065) is bromobenzene;ethyl 9H-carbazole-3-carboxylate;ethyl 9-phenylcarbazole-3-carboxylate.
What is the SMILES notation for bromobenzene;ethyl 9H-carbazole-3-carboxylate;ethyl 9-phenylcarbazole-3-carboxylate?
The canonical SMILES for bromobenzene;ethyl 9H-carbazole-3-carboxylate;ethyl 9-phenylcarbazole-3-carboxylate is Brc1ccccc1.CCOC(=O)c1ccc2[nH]c3ccccc3c2c1.CCOC(=O)c1ccc2c(c1)c1ccccc1n2-c1ccccc1.
What is the InChIKey of bromobenzene;ethyl 9H-carbazole-3-carboxylate;ethyl 9-phenylcarbazole-3-carboxylate?
The InChIKey is MCNDBNLHGFFYHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17NO2.C15H13NO2.C6H5Br/c1-2-24-21(23)15-12-13-20-18(14-15)17-10-6-7-11-19(17)22(20)16-8-4-3-5-9-16;1-2-18-15(17)10-7-8-14-12(9-10)11-5-3-4-6-13(11)16-14;7-6-4-2-1-3-5-6/h3-14H,2H2,1H3;3-9,16H,2H2,1H3;1-5H.
What are the key properties of bromobenzene;ethyl 9H-carbazole-3-carboxylate;ethyl 9-phenylcarbazole-3-carboxylate?
bromobenzene;ethyl 9H-carbazole-3-carboxylate;ethyl 9-phenylcarbazole-3-carboxylate has a molecular weight of 711.66 g/mol, XLogP of 10.91, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bromobenzene;ethyl 9H-carbazole-3-carboxylate;ethyl 9-phenylcarbazole-3-carboxylate is sourced from PubChem (CID 159527065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).