C26H20Br2F2N6O — CID 159527256
3-(4-bromo-2-fluorophenyl)-1-cyclopentyl-4-isocyanopyrazol-5-amine;(E)-3-(4-bromo-2-fluorophenyl)-2-isocyano-3-methoxyprop-2-enenitrile (PubChem CID 159527256) has the molecular formula C26H20Br2F2N6O and a molecular weight of 630.29 g/mol. Its IUPAC name is 3-(4-bromo-2-fluorophenyl)-1-cyclopentyl-4-isocyanopyrazol-5-amine;(E)-3-(4-bromo-2-fluorophenyl)-2-isocyano-3-methoxyprop-2-enenitrile.
| Compound Name | 3-(4-bromo-2-fluorophenyl)-1-cyclopentyl-4-isocyanopyrazol-5-amine;(E)-3-(4-bromo-2-fluorophenyl)-2-isocyano-3-methoxyprop-2-enenitrile |
|---|---|
| PubChem CID | 159527256 |
| Molecular Formula | C26H20Br2F2N6O |
| Molecular Weight | 630.29 g/mol |
| Exact Mass | 628.00 |
| IUPAC Name | 3-(4-bromo-2-fluorophenyl)-1-cyclopentyl-4-isocyanopyrazol-5-amine;(E)-3-(4-bromo-2-fluorophenyl)-2-isocyano-3-methoxyprop-2-enenitrile |
| SMILES | [C-]#[N+]/C(C#N)=C(/OC)c1ccc(Br)cc1F.[C-]#[N+]c1c(-c2ccc(Br)cc2F)nn(C2CCCC2)c1N |
| InChI | InChI=1S/C15H14BrFN4.C11H6BrFN2O/c1-19-14-13(11-7-6-9(16)8-12(11)17)20-21(15(14)18)10-4-2-3-5-10;1-15-10(6-14)11(16-2)8-4-3-7(12)5-9(8)13/h6-8,10H,2-5,18H2;3-5H,2H3/b;11-10+ |
| InChIKey | MCNQXZIMQDZWRT-AZQMUMGESA-N |
| XLogP | 8.05 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.29 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|