C9H14BF6NO3 — CID 159527712
[(E)-1,1-difluoro-4-methoxy-3-methoxycarbonylbut-3-en-2-ylidene]-dimethylazanium;trifluoroborane;fluoride (PubChem CID 159527712) has the molecular formula C9H14BF6NO3 and a molecular weight of 309.02 g/mol. Its IUPAC name is [(E)-1,1-difluoro-4-methoxy-3-methoxycarbonylbut-3-en-2-ylidene]-dimethylazanium;trifluoroborane;fluoride.
| Compound Name | [(E)-1,1-difluoro-4-methoxy-3-methoxycarbonylbut-3-en-2-ylidene]-dimethylazanium;trifluoroborane;fluoride |
|---|---|
| PubChem CID | 159527712 |
| Molecular Formula | C9H14BF6NO3 |
| Molecular Weight | 309.02 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | [(E)-1,1-difluoro-4-methoxy-3-methoxycarbonylbut-3-en-2-ylidene]-dimethylazanium;trifluoroborane;fluoride |
| SMILES | CO/C=C(/C(=O)OC)C(C(F)F)=[N+](C)C.FB(F)F.[F-] |
| InChI | InChI=1S/C9H14F2NO3.BF3.FH/c1-12(2)7(8(10)11)6(5-14-3)9(13)15-4;2-1(3)4;/h5,8H,1-4H3;;1H/q+1;;/p-1/b6-5+;; |
| InChIKey | MCPBDHCFKZZBSK-TXOOBNKBSA-M |
| XLogP | -1.45 |
| TPSA | 38.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.02 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|