C9H16N4O2 — CID 159527951
6-methylidene-1,3-diazinane-2,4-dione;piperazine (PubChem CID 159527951) has the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is 6-methylidene-1,3-diazinane-2,4-dione;piperazine.
| Compound Name | 6-methylidene-1,3-diazinane-2,4-dione;piperazine |
|---|---|
| PubChem CID | 159527951 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 6-methylidene-1,3-diazinane-2,4-dione;piperazine |
| SMILES | C1CNCCN1.C=C1CC(=O)NC(=O)N1 |
| InChI | InChI=1S/C5H6N2O2.C4H10N2/c1-3-2-4(8)7-5(9)6-3;1-2-6-4-3-5-1/h1-2H2,(H2,6,7,8,9);5-6H,1-4H2 |
| InChIKey | MCPSJFUVSRLZQE-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |