C12H16N4O5 — CID 160554598
1,3-dimethyl-1,3-diazinane-2,4,6-trione;3-methyl-6-methylidene-1,3-diazinane-2,4-dione (PubChem CID 160554598) has the molecular formula C12H16N4O5 and a molecular weight of 296.28 g/mol. Its IUPAC name is 1,3-dimethyl-1,3-diazinane-2,4,6-trione;3-methyl-6-methylidene-1,3-diazinane-2,4-dione.
| Compound Name | 1,3-dimethyl-1,3-diazinane-2,4,6-trione;3-methyl-6-methylidene-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 160554598 |
| Molecular Formula | C12H16N4O5 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 1,3-dimethyl-1,3-diazinane-2,4,6-trione;3-methyl-6-methylidene-1,3-diazinane-2,4-dione |
| SMILES | C=C1CC(=O)N(C)C(=O)N1.CN1C(=O)CC(=O)N(C)C1=O |
| InChI | InChI=1S/C6H8N2O3.C6H8N2O2/c1-7-4(9)3-5(10)8(2)6(7)11;1-4-3-5(9)8(2)6(10)7-4/h3H2,1-2H3;1,3H2,2H3,(H,7,10) |
| InChIKey | QYMZKLCQENZEDW-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|