C6H8N2O2 — CID 160554599
3-methyl-6-methylidene-1,3-diazinane-2,4-dione (PubChem CID 160554599) has the molecular formula C6H8N2O2 and a molecular weight of 140.14 g/mol. Its IUPAC name is 3-methyl-6-methylidene-1,3-diazinane-2,4-dione.
| Compound Name | 3-methyl-6-methylidene-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 160554599 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 3-methyl-6-methylidene-1,3-diazinane-2,4-dione |
| SMILES | C=C1CC(=O)N(C)C(=O)N1 |
| InChI | InChI=1S/C6H8N2O2/c1-4-3-5(9)8(2)6(10)7-4/h1,3H2,2H3,(H,7,10) |
| InChIKey | XQMUCUYNCZPAHS-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |