C20H38OS — CID 159531790
(2S,3S)-2,3-diethyl-6-methyl-3,6-dihydro-2H-pyran;(4S,5S)-4,5-diethyl-2-methylthiane (PubChem CID 159531790) has the molecular formula C20H38OS and a molecular weight of 326.59 g/mol. Its IUPAC name is (2S,3S)-2,3-diethyl-6-methyl-3,6-dihydro-2H-pyran;(4S,5S)-4,5-diethyl-2-methylthiane.
| Compound Name | (2S,3S)-2,3-diethyl-6-methyl-3,6-dihydro-2H-pyran;(4S,5S)-4,5-diethyl-2-methylthiane |
|---|---|
| PubChem CID | 159531790 |
| Molecular Formula | C20H38OS |
| Molecular Weight | 326.59 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | (2S,3S)-2,3-diethyl-6-methyl-3,6-dihydro-2H-pyran;(4S,5S)-4,5-diethyl-2-methylthiane |
| SMILES | CC[C@@H]1CSC(C)C[C@@H]1CC.CC[C@H]1C=CC(C)O[C@H]1CC |
| InChI | InChI=1S/C10H18O.C10H20S/c1-4-9-7-6-8(3)11-10(9)5-2;1-4-9-6-8(3)11-7-10(9)5-2/h6-10H,4-5H2,1-3H3;8-10H,4-7H2,1-3H3/t8?,9-,10-;8?,9-,10+/m00/s1 |
| InChIKey | MDBYXOAVSZOOMR-VKVQWRFBSA-N |
| XLogP | 6.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.59 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|