C18H34OS — CID 176871476
(7Z)-2,10,11-tri(propan-2-yl)-1-oxa-3-thiacycloundec-7-ene (PubChem CID 176871476) has the molecular formula C18H34OS and a molecular weight of 298.54 g/mol. Its IUPAC name is (7Z)-2,10,11-tri(propan-2-yl)-1-oxa-3-thiacycloundec-7-ene.
| Compound Name | (7Z)-2,10,11-tri(propan-2-yl)-1-oxa-3-thiacycloundec-7-ene |
|---|---|
| PubChem CID | 176871476 |
| Molecular Formula | C18H34OS |
| Molecular Weight | 298.54 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | (7Z)-2,10,11-tri(propan-2-yl)-1-oxa-3-thiacycloundec-7-ene |
| SMILES | CC(C)C1OC(C(C)C)C(C(C)C)C/C=C\CCCS1 |
| InChI | InChI=1S/C18H34OS/c1-13(2)16-11-9-7-8-10-12-20-18(15(5)6)19-17(16)14(3)4/h7,9,13-18H,8,10-12H2,1-6H3/b9-7- |
| InChIKey | GDMLCYFQZCLABH-CLFYSBASSA-N |
| XLogP | 5.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.54 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|