C14H26OS2 — CID 10967726
2-[(E,2R,3R,4S)-3-methoxy-4-methyloct-6-en-2-yl]-1,3-dithiane (PubChem CID 10967726) has the molecular formula C14H26OS2 and a molecular weight of 274.49 g/mol. Its IUPAC name is 2-[(E,2R,3R,4S)-3-methoxy-4-methyloct-6-en-2-yl]-1,3-dithiane.
| Compound Name | 2-[(E,2R,3R,4S)-3-methoxy-4-methyloct-6-en-2-yl]-1,3-dithiane |
|---|---|
| PubChem CID | 10967726 |
| Molecular Formula | C14H26OS2 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2-[(E,2R,3R,4S)-3-methoxy-4-methyloct-6-en-2-yl]-1,3-dithiane |
| SMILES | C/C=C/C[C@H](C)[C@@H](OC)[C@@H](C)C1SCCCS1 |
| InChI | InChI=1S/C14H26OS2/c1-5-6-8-11(2)13(15-4)12(3)14-16-9-7-10-17-14/h5-6,11-14H,7-10H2,1-4H3/b6-5+/t11-,12+,13+/m0/s1 |
| InChIKey | WECGHUNEYHZWJL-NEFWEQRUSA-N |
| XLogP | 4.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|