C16H30OS — CID 176871504
(5Z)-2,8,9-tri(propan-2-yl)-4,7,8,9-tetrahydro-1,3-oxathionine (PubChem CID 176871504) has the molecular formula C16H30OS and a molecular weight of 270.48 g/mol. Its IUPAC name is (5Z)-2,8,9-tri(propan-2-yl)-4,7,8,9-tetrahydro-1,3-oxathionine.
| Compound Name | (5Z)-2,8,9-tri(propan-2-yl)-4,7,8,9-tetrahydro-1,3-oxathionine |
|---|---|
| PubChem CID | 176871504 |
| Molecular Formula | C16H30OS |
| Molecular Weight | 270.48 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | (5Z)-2,8,9-tri(propan-2-yl)-4,7,8,9-tetrahydro-1,3-oxathionine |
| SMILES | CC(C)C1OC(C(C)C)C(C(C)C)C/C=C\CS1 |
| InChI | InChI=1S/C16H30OS/c1-11(2)14-9-7-8-10-18-16(13(5)6)17-15(14)12(3)4/h7-8,11-16H,9-10H2,1-6H3/b8-7- |
| InChIKey | NOIRDRHZFWTTCV-FPLPWBNLSA-N |
| XLogP | 4.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|