C19H36OS — CID 142816871
ethane;(2E,8Z)-1-(4-ethenoxybutylsulfanyl)-4-methyldeca-2,8-diene (PubChem CID 142816871) has the molecular formula C19H36OS and a molecular weight of 312.56 g/mol. Its IUPAC name is ethane;(2E,8Z)-1-(4-ethenoxybutylsulfanyl)-4-methyldeca-2,8-diene.
| Compound Name | ethane;(2E,8Z)-1-(4-ethenoxybutylsulfanyl)-4-methyldeca-2,8-diene |
|---|---|
| PubChem CID | 142816871 |
| Molecular Formula | C19H36OS |
| Molecular Weight | 312.56 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | ethane;(2E,8Z)-1-(4-ethenoxybutylsulfanyl)-4-methyldeca-2,8-diene |
| SMILES | C=COCCCCSC/C=C/C(C)CCC/C=C\C.CC |
| InChI | InChI=1S/C17H30OS.C2H6/c1-4-6-7-8-12-17(3)13-11-16-19-15-10-9-14-18-5-2;1-2/h4-6,11,13,17H,2,7-10,12,14-16H2,1,3H3;1-2H3/b6-4-,13-11+; |
| InChIKey | IDIYOVUXKZKWEB-MPRZCWPVSA-N |
| XLogP | 6.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.56 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|