C18H34OS — CID 57240776
(3S,4R)-3-hept-2-enyl-4-(hexoxymethyl)thiolane (PubChem CID 57240776) has the molecular formula C18H34OS and a molecular weight of 298.54 g/mol. Its IUPAC name is (3S,4R)-3-hept-2-enyl-4-(hexoxymethyl)thiolane.
| Compound Name | (3S,4R)-3-hept-2-enyl-4-(hexoxymethyl)thiolane |
|---|---|
| PubChem CID | 57240776 |
| Molecular Formula | C18H34OS |
| Molecular Weight | 298.54 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | (3S,4R)-3-hept-2-enyl-4-(hexoxymethyl)thiolane |
| SMILES | CCCCC=CC[C@@H]1CSC[C@H]1COCCCCCC |
| InChI | InChI=1S/C18H34OS/c1-3-5-7-9-10-12-17-15-20-16-18(17)14-19-13-11-8-6-4-2/h9-10,17-18H,3-8,11-16H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | GYQLNDBMOPXHJY-QZTJIDSGSA-N |
| XLogP | 5.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|