C30H52O2S5 — CID 88819543
O-(2-ethylhexyl) [(5E)-9-(2-ethylhexoxycarbothioylsulfanyl)-13-thiabicyclo[8.2.1]tridec-5-en-2-yl]sulfanylmethanethioate (PubChem CID 88819543) has the molecular formula C30H52O2S5 and a molecular weight of 605.08 g/mol. Its IUPAC name is O-(2-ethylhexyl) [(5E)-9-(2-ethylhexoxycarbothioylsulfanyl)-13-thiabicyclo[8.2.1]tridec-5-en-2-yl]sulfanylmethanethioate.
| Compound Name | O-(2-ethylhexyl) [(5E)-9-(2-ethylhexoxycarbothioylsulfanyl)-13-thiabicyclo[8.2.1]tridec-5-en-2-yl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 88819543 |
| Molecular Formula | C30H52O2S5 |
| Molecular Weight | 605.08 g/mol |
| Exact Mass | 604.26 |
| IUPAC Name | O-(2-ethylhexyl) [(5E)-9-(2-ethylhexoxycarbothioylsulfanyl)-13-thiabicyclo[8.2.1]tridec-5-en-2-yl]sulfanylmethanethioate |
| SMILES | CCCCC(CC)COC(=S)SC1CC/C=C/CCC(SC(=S)OCC(CC)CCCC)C2CCC1S2 |
| InChI | InChI=1S/C30H52O2S5/c1-5-9-15-23(7-3)21-31-29(33)36-25-17-13-11-12-14-18-26(28-20-19-27(25)35-28)37-30(34)32-22-24(8-4)16-10-6-2/h11-12,23-28H,5-10,13-22H2,1-4H3/b12-11+ |
| InChIKey | VETCNMQIFQTVFU-VAWYXSNFSA-N |
| XLogP | 10.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.08 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|