About O-(2-ethylnonyl) ethanethioate
O-(2-ethylnonyl) ethanethioate (PubChem CID 87549107) has the molecular formula C13H26OS
and a molecular weight of 230.42 g/mol. Its IUPAC name is O-(2-ethylnonyl) ethanethioate.
Molecular Properties
| Compound Name | O-(2-ethylnonyl) ethanethioate |
| PubChem CID | 87549107 |
| Molecular Formula | C13H26OS |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | O-(2-ethylnonyl) ethanethioate |
| SMILES | CCCCCCCC(CC)COC(C)=S |
| InChI | InChI=1S/C13H26OS/c1-4-6-7-8-9-10-13(5-2)11-14-12(3)15/h13H,4-11H2,1-3H3 |
| InChIKey | AWFZBZLXZDRUKJ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(2-ethylnonyl) ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(2-ethylnonyl) ethanethioate?
The IUPAC name of O-(2-ethylnonyl) ethanethioate (CID 87549107) is O-(2-ethylnonyl) ethanethioate.
What is the SMILES notation for O-(2-ethylnonyl) ethanethioate?
The canonical SMILES for O-(2-ethylnonyl) ethanethioate is CCCCCCCC(CC)COC(C)=S.
What is the InChIKey of O-(2-ethylnonyl) ethanethioate?
The InChIKey is AWFZBZLXZDRUKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26OS/c1-4-6-7-8-9-10-13(5-2)11-14-12(3)15/h13H,4-11H2,1-3H3.
What are the key properties of O-(2-ethylnonyl) ethanethioate?
O-(2-ethylnonyl) ethanethioate has a molecular weight of 230.42 g/mol, XLogP of 4.74, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-(2-ethylnonyl) ethanethioate is sourced from PubChem (CID 87549107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).