About 4-tert-butylcyclopentene;4-tert-butyloxane;3-tert-butylthiolane
4-tert-butylcyclopentene;4-tert-butyloxane;3-tert-butylthiolane (PubChem CID 157261746) has the molecular formula C26H50OS
and a molecular weight of 410.75 g/mol. Its IUPAC name is 4-tert-butylcyclopentene;4-tert-butyloxane;3-tert-butylthiolane.
Molecular Properties
| Compound Name | 4-tert-butylcyclopentene;4-tert-butyloxane;3-tert-butylthiolane |
| PubChem CID | 157261746 |
| Molecular Formula | C26H50OS |
| Molecular Weight | 410.75 g/mol |
| Exact Mass | 410.36 |
| IUPAC Name | 4-tert-butylcyclopentene;4-tert-butyloxane;3-tert-butylthiolane |
| SMILES | CC(C)(C)C1CC=CC1.CC(C)(C)C1CCOCC1.CC(C)(C)C1CCSC1 |
| InChI | InChI=1S/C9H18O.C9H16.C8H16S/c1-9(2,3)8-4-6-10-7-5-8;1-9(2,3)8-6-4-5-7-8;1-8(2,3)7-4-5-9-6-7/h8H,4-7H2,1-3H3;4-5,8H,6-7H2,1-3H3;7H,4-6H2,1-3H3 |
| InChIKey | AXNSCDOTNXPKHZ-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.75 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butylcyclopentene;4-tert-butyloxane;3-tert-butylthiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butylcyclopentene;4-tert-butyloxane;3-tert-butylthiolane?
The IUPAC name of 4-tert-butylcyclopentene;4-tert-butyloxane;3-tert-butylthiolane (CID 157261746) is 4-tert-butylcyclopentene;4-tert-butyloxane;3-tert-butylthiolane.
What is the SMILES notation for 4-tert-butylcyclopentene;4-tert-butyloxane;3-tert-butylthiolane?
The canonical SMILES for 4-tert-butylcyclopentene;4-tert-butyloxane;3-tert-butylthiolane is CC(C)(C)C1CC=CC1.CC(C)(C)C1CCOCC1.CC(C)(C)C1CCSC1.
What is the InChIKey of 4-tert-butylcyclopentene;4-tert-butyloxane;3-tert-butylthiolane?
The InChIKey is AXNSCDOTNXPKHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O.C9H16.C8H16S/c1-9(2,3)8-4-6-10-7-5-8;1-9(2,3)8-6-4-5-7-8;1-8(2,3)7-4-5-9-6-7/h8H,4-7H2,1-3H3;4-5,8H,6-7H2,1-3H3;7H,4-6H2,1-3H3.
What are the key properties of 4-tert-butylcyclopentene;4-tert-butyloxane;3-tert-butylthiolane?
4-tert-butylcyclopentene;4-tert-butyloxane;3-tert-butylthiolane has a molecular weight of 410.75 g/mol, XLogP of 8.24, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butylcyclopentene;4-tert-butyloxane;3-tert-butylthiolane is sourced from PubChem (CID 157261746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).