C29H56OS — CID 161319509
1-(2,2-dimethylpropyl)cyclopentene;4-(2,2-dimethylpropyl)oxane;3-(2,2-dimethylpropyl)thiolane (PubChem CID 161319509) has the molecular formula C29H56OS and a molecular weight of 452.83 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)cyclopentene;4-(2,2-dimethylpropyl)oxane;3-(2,2-dimethylpropyl)thiolane.
| Compound Name | 1-(2,2-dimethylpropyl)cyclopentene;4-(2,2-dimethylpropyl)oxane;3-(2,2-dimethylpropyl)thiolane |
|---|---|
| PubChem CID | 161319509 |
| Molecular Formula | C29H56OS |
| Molecular Weight | 452.83 g/mol |
| Exact Mass | 452.41 |
| IUPAC Name | 1-(2,2-dimethylpropyl)cyclopentene;4-(2,2-dimethylpropyl)oxane;3-(2,2-dimethylpropyl)thiolane |
| SMILES | CC(C)(C)CC1=CCCC1.CC(C)(C)CC1CCOCC1.CC(C)(C)CC1CCSC1 |
| InChI | InChI=1S/C10H20O.C10H18.C9H18S/c1-10(2,3)8-9-4-6-11-7-5-9;1-10(2,3)8-9-6-4-5-7-9;1-9(2,3)6-8-4-5-10-7-8/h9H,4-8H2,1-3H3;6H,4-5,7-8H2,1-3H3;8H,4-7H2,1-3H3 |
| InChIKey | VJYLFGJTANEPBR-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.83 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|