C21H36OS — CID 91222547
9-(1-butylsulfanylethenyl)-13-ethoxytrideca-2,5,10-triene (PubChem CID 91222547) has the molecular formula C21H36OS and a molecular weight of 336.59 g/mol. Its IUPAC name is 9-(1-butylsulfanylethenyl)-13-ethoxytrideca-2,5,10-triene.
| Compound Name | 9-(1-butylsulfanylethenyl)-13-ethoxytrideca-2,5,10-triene |
|---|---|
| PubChem CID | 91222547 |
| Molecular Formula | C21H36OS |
| Molecular Weight | 336.59 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 9-(1-butylsulfanylethenyl)-13-ethoxytrideca-2,5,10-triene |
| SMILES | C=C(SCCCC)C(C=CCCOCC)CCC=CCC=CC |
| InChI | InChI=1S/C21H36OS/c1-5-8-10-11-12-13-16-21(17-14-15-18-22-7-3)20(4)23-19-9-6-2/h5,8,11-12,14,17,21H,4,6-7,9-10,13,15-16,18-19H2,1-3H3 |
| InChIKey | LCOPGAWQIJAFID-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.59 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|