C14H24OS2 — CID 122372800
(E,2R,3S)-2-(2-prop-2-enyl-1,3-dithian-2-yl)hept-5-en-3-ol (PubChem CID 122372800) has the molecular formula C14H24OS2 and a molecular weight of 272.48 g/mol. Its IUPAC name is (E,2R,3S)-2-(2-prop-2-enyl-1,3-dithian-2-yl)hept-5-en-3-ol.
| Compound Name | (E,2R,3S)-2-(2-prop-2-enyl-1,3-dithian-2-yl)hept-5-en-3-ol |
|---|---|
| PubChem CID | 122372800 |
| Molecular Formula | C14H24OS2 |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (E,2R,3S)-2-(2-prop-2-enyl-1,3-dithian-2-yl)hept-5-en-3-ol |
| SMILES | C=CCC1([C@H](C)[C@@H](O)C/C=C/C)SCCCS1 |
| InChI | InChI=1S/C14H24OS2/c1-4-6-8-13(15)12(3)14(9-5-2)16-10-7-11-17-14/h4-6,12-13,15H,2,7-11H2,1,3H3/b6-4+/t12-,13+/m1/s1 |
| InChIKey | PNTPZRUBBFFKFQ-PBYRWIMMSA-N |
| XLogP | 4.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|