C15H28OS2 — CID 100978301
2-[(E,2R,3R,4S)-3-methoxy-2,4-dimethyloct-6-enyl]-1,3-dithiane (PubChem CID 100978301) has the molecular formula C15H28OS2 and a molecular weight of 288.52 g/mol. Its IUPAC name is 2-[(E,2R,3R,4S)-3-methoxy-2,4-dimethyloct-6-enyl]-1,3-dithiane.
| Compound Name | 2-[(E,2R,3R,4S)-3-methoxy-2,4-dimethyloct-6-enyl]-1,3-dithiane |
|---|---|
| PubChem CID | 100978301 |
| Molecular Formula | C15H28OS2 |
| Molecular Weight | 288.52 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 2-[(E,2R,3R,4S)-3-methoxy-2,4-dimethyloct-6-enyl]-1,3-dithiane |
| SMILES | C/C=C/C[C@H](C)[C@@H](OC)[C@H](C)CC1SCCCS1 |
| InChI | InChI=1S/C15H28OS2/c1-5-6-8-12(2)15(16-4)13(3)11-14-17-9-7-10-18-14/h5-6,12-15H,7-11H2,1-4H3/b6-5+/t12-,13+,15+/m0/s1 |
| InChIKey | GFYVFVSMDDADCR-RVZFVFSMSA-N |
| XLogP | 4.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|