C12H20OS — CID 70546085
4-cyclohex-3-en-1-yl-2,6-dimethyl-1,3-oxathiane (PubChem CID 70546085) has the molecular formula C12H20OS and a molecular weight of 212.36 g/mol. Its IUPAC name is 4-cyclohex-3-en-1-yl-2,6-dimethyl-1,3-oxathiane.
| Compound Name | 4-cyclohex-3-en-1-yl-2,6-dimethyl-1,3-oxathiane |
|---|---|
| PubChem CID | 70546085 |
| Molecular Formula | C12H20OS |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 4-cyclohex-3-en-1-yl-2,6-dimethyl-1,3-oxathiane |
| SMILES | CC1CC(C2CC=CCC2)SC(C)O1 |
| InChI | InChI=1S/C12H20OS/c1-9-8-12(14-10(2)13-9)11-6-4-3-5-7-11/h3-4,9-12H,5-8H2,1-2H3 |
| InChIKey | LGCBIQWXGRTOBT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|