C15H26OS — CID 20582808
4,4-dimethyl-2-(2,4,6-trimethylcyclohex-3-en-1-yl)-1,3-oxathiane (PubChem CID 20582808) has the molecular formula C15H26OS and a molecular weight of 254.44 g/mol. Its IUPAC name is 4,4-dimethyl-2-(2,4,6-trimethylcyclohex-3-en-1-yl)-1,3-oxathiane.
| Compound Name | 4,4-dimethyl-2-(2,4,6-trimethylcyclohex-3-en-1-yl)-1,3-oxathiane |
|---|---|
| PubChem CID | 20582808 |
| Molecular Formula | C15H26OS |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 4,4-dimethyl-2-(2,4,6-trimethylcyclohex-3-en-1-yl)-1,3-oxathiane |
| SMILES | CC1=CC(C)C(C2OCCC(C)(C)S2)C(C)C1 |
| InChI | InChI=1S/C15H26OS/c1-10-8-11(2)13(12(3)9-10)14-16-7-6-15(4,5)17-14/h8,11-14H,6-7,9H2,1-5H3 |
| InChIKey | HVKCJZRGZKJFSG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|