C12H22OS — CID 11206674
2-(2,6-dimethylhept-5-enyl)-1,3-oxathiolane (PubChem CID 11206674) has the molecular formula C12H22OS and a molecular weight of 214.37 g/mol. Its IUPAC name is 2-(2,6-dimethylhept-5-enyl)-1,3-oxathiolane.
| Compound Name | 2-(2,6-dimethylhept-5-enyl)-1,3-oxathiolane |
|---|---|
| PubChem CID | 11206674 |
| Molecular Formula | C12H22OS |
| Molecular Weight | 214.37 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 2-(2,6-dimethylhept-5-enyl)-1,3-oxathiolane |
| SMILES | CC(C)=CCCC(C)CC1OCCS1 |
| InChI | InChI=1S/C12H22OS/c1-10(2)5-4-6-11(3)9-12-13-7-8-14-12/h5,11-12H,4,6-9H2,1-3H3 |
| InChIKey | XZYVRGGEKPUZQV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|