C13H24OS — CID 101267568
2-(3,7-dimethyloct-6-enyl)-1,3-oxathiolane (PubChem CID 101267568) has the molecular formula C13H24OS and a molecular weight of 228.40 g/mol. Its IUPAC name is 2-(3,7-dimethyloct-6-enyl)-1,3-oxathiolane.
| Compound Name | 2-(3,7-dimethyloct-6-enyl)-1,3-oxathiolane |
|---|---|
| PubChem CID | 101267568 |
| Molecular Formula | C13H24OS |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 2-(3,7-dimethyloct-6-enyl)-1,3-oxathiolane |
| SMILES | CC(C)=CCCC(C)CCC1OCCS1 |
| InChI | InChI=1S/C13H24OS/c1-11(2)5-4-6-12(3)7-8-13-14-9-10-15-13/h5,12-13H,4,6-10H2,1-3H3 |
| InChIKey | MBARHLUXIPKPQX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|