C13H24OS — CID 91365829
2-(2-ethylhexoxymethyl)-2,3-dihydrothiophene (PubChem CID 91365829) has the molecular formula C13H24OS and a molecular weight of 228.40 g/mol. Its IUPAC name is 2-(2-ethylhexoxymethyl)-2,3-dihydrothiophene.
| Compound Name | 2-(2-ethylhexoxymethyl)-2,3-dihydrothiophene |
|---|---|
| PubChem CID | 91365829 |
| Molecular Formula | C13H24OS |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 2-(2-ethylhexoxymethyl)-2,3-dihydrothiophene |
| SMILES | CCCCC(CC)COCC1CC=CS1 |
| InChI | InChI=1S/C13H24OS/c1-3-5-7-12(4-2)10-14-11-13-8-6-9-15-13/h6,9,12-13H,3-5,7-8,10-11H2,1-2H3 |
| InChIKey | IKZSSTLCLQPXSW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |