C16H28OS — CID 20582809
4,4-dimethyl-2-[2-(4-methylcyclohex-3-en-1-yl)propyl]-1,3-oxathiane (PubChem CID 20582809) has the molecular formula C16H28OS and a molecular weight of 268.47 g/mol. Its IUPAC name is 4,4-dimethyl-2-[2-(4-methylcyclohex-3-en-1-yl)propyl]-1,3-oxathiane.
| Compound Name | 4,4-dimethyl-2-[2-(4-methylcyclohex-3-en-1-yl)propyl]-1,3-oxathiane |
|---|---|
| PubChem CID | 20582809 |
| Molecular Formula | C16H28OS |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 4,4-dimethyl-2-[2-(4-methylcyclohex-3-en-1-yl)propyl]-1,3-oxathiane |
| SMILES | CC1=CCC(C(C)CC2OCCC(C)(C)S2)CC1 |
| InChI | InChI=1S/C16H28OS/c1-12-5-7-14(8-6-12)13(2)11-15-17-10-9-16(3,4)18-15/h5,13-15H,6-11H2,1-4H3 |
| InChIKey | CYMABUVRSMTRNF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|